C26H26Cl2N2O5S — CID 23119056
(E)-3-[4-[[4-[3-(butoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methylprop-2-enoic acid (PubChem CID 23119056) has the molecular formula C26H26Cl2N2O5S and a molecular weight of 549.48 g/mol. Its IUPAC name is (E)-3-[4-[[4-[3-(butoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[3-(butoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119056 |
| Molecular Formula | C26H26Cl2N2O5S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | (E)-3-[4-[[4-[3-(butoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCOCc1cccc(-c2csc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)n2)c1OC |
| InChI | InChI=1S/C26H26Cl2N2O5S/c1-4-5-9-35-13-16-7-6-8-18(23(16)34-3)22-14-36-26(29-22)30-24(31)17-11-20(27)19(21(28)12-17)10-15(2)25(32)33/h6-8,10-12,14H,4-5,9,13H2,1-3H3,(H,32,33)(H,29,30,31)/b15-10+ |
| InChIKey | SFKAGJPKAVKUFA-XNTDXEJSSA-N |
| XLogP | 7.18 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|