C31H34Cl2N2O5S — CID 91490054
3-[2,6-dichloro-4-[[4-[3-(3-cyclohexylpropoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 91490054) has the molecular formula C31H34Cl2N2O5S and a molecular weight of 617.60 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[[4-[3-(3-cyclohexylpropoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[[4-[3-(3-cyclohexylpropoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 91490054 |
| Molecular Formula | C31H34Cl2N2O5S |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 3-[2,6-dichloro-4-[[4-[3-(3-cyclohexylpropoxymethyl)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1c(COCCCC2CCCCC2)cccc1-c1csc(NC(=O)c2cc(Cl)c(C=C(C)C(=O)O)c(Cl)c2)n1 |
| InChI | InChI=1S/C31H34Cl2N2O5S/c1-19(30(37)38)14-24-25(32)15-22(16-26(24)33)29(36)35-31-34-27(18-41-31)23-12-6-11-21(28(23)39-2)17-40-13-7-10-20-8-4-3-5-9-20/h6,11-12,14-16,18,20H,3-5,7-10,13,17H2,1-2H3,(H,37,38)(H,34,35,36) |
| InChIKey | BSIREQFAIMVIFT-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|