C28H28F2N2O5S — CID 23119099
(E)-3-[4-[[4-[3-[3-(cyclopropylmethoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid (PubChem CID 23119099) has the molecular formula C28H28F2N2O5S and a molecular weight of 542.60 g/mol. Its IUPAC name is (E)-3-[4-[[4-[3-[3-(cyclopropylmethoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[3-[3-(cyclopropylmethoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119099 |
| Molecular Formula | C28H28F2N2O5S |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (E)-3-[4-[[4-[3-[3-(cyclopropylmethoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1c(CCCOCC2CC2)cccc1-c1csc(NC(=O)c2cc(F)c(/C=C(\C)C(=O)O)c(F)c2)n1 |
| InChI | InChI=1S/C28H28F2N2O5S/c1-16(27(34)35)11-21-22(29)12-19(13-23(21)30)26(33)32-28-31-24(15-38-28)20-7-3-5-18(25(20)36-2)6-4-10-37-14-17-8-9-17/h3,5,7,11-13,15,17H,4,6,8-10,14H2,1-2H3,(H,34,35)(H,31,32,33)/b16-11+ |
| InChIKey | RCAPKCIAGLGSII-LFIBNONCSA-N |
| XLogP | 6.20 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|