C30H34F2N2O6S — CID 87680676
(Z)-3-[4-[[4-[3-[3-(2-ethylbutoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid (PubChem CID 87680676) has the molecular formula C30H34F2N2O6S and a molecular weight of 588.67 g/mol. Its IUPAC name is (Z)-3-[4-[[4-[3-[3-(2-ethylbutoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[[4-[3-[3-(2-ethylbutoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 87680676 |
| Molecular Formula | C30H34F2N2O6S |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (Z)-3-[4-[[4-[3-[3-(2-ethylbutoxy)propyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CCC(CC)COCCCc1cccc(-c2csc(NC(=O)c3cc(F)c(/C=C(\OC)C(=O)O)c(F)c3)n2)c1OC |
| InChI | InChI=1S/C30H34F2N2O6S/c1-5-18(6-2)16-40-12-8-10-19-9-7-11-21(27(19)39-4)25-17-41-30(33-25)34-28(35)20-13-23(31)22(24(32)14-20)15-26(38-3)29(36)37/h7,9,11,13-15,17-18H,5-6,8,10,12,16H2,1-4H3,(H,36,37)(H,33,34,35)/b26-15- |
| InChIKey | NILXXYBJTQGUOU-YSMPRRRNSA-N |
| XLogP | 6.81 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|