C25H23ClF2N2O6S — CID 74018454
3-[4-[[4-[3-(4-chlorobutoxy)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid (PubChem CID 74018454) has the molecular formula C25H23ClF2N2O6S and a molecular weight of 552.98 g/mol. Its IUPAC name is 3-[4-[[4-[3-(4-chlorobutoxy)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | 3-[4-[[4-[3-(4-chlorobutoxy)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 74018454 |
| Molecular Formula | C25H23ClF2N2O6S |
| Molecular Weight | 552.98 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 3-[4-[[4-[3-(4-chlorobutoxy)-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
| SMILES | COC(=Cc1c(F)cc(C(=O)Nc2nc(-c3cccc(OCCCCCl)c3OC)cs2)cc1F)C(=O)O |
| InChI | InChI=1S/C25H23ClF2N2O6S/c1-34-21(24(32)33)12-16-17(27)10-14(11-18(16)28)23(31)30-25-29-19(13-37-25)15-6-5-7-20(22(15)35-2)36-9-4-3-8-26/h5-7,10-13H,3-4,8-9H2,1-2H3,(H,32,33)(H,29,30,31) |
| InChIKey | PUAKQUXNYBYQFG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.98 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|