C28H30F2N2O6S — CID 91544220
3-[2,6-difluoro-4-[[4-[2-methoxy-3-[2-(3-methylbutoxy)ethyl]phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid (PubChem CID 91544220) has the molecular formula C28H30F2N2O6S and a molecular weight of 560.62 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[[4-[2-methoxy-3-[2-(3-methylbutoxy)ethyl]phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | 3-[2,6-difluoro-4-[[4-[2-methoxy-3-[2-(3-methylbutoxy)ethyl]phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 91544220 |
| Molecular Formula | C28H30F2N2O6S |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 3-[2,6-difluoro-4-[[4-[2-methoxy-3-[2-(3-methylbutoxy)ethyl]phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
| SMILES | COC(=Cc1c(F)cc(C(=O)Nc2nc(-c3cccc(CCOCCC(C)C)c3OC)cs2)cc1F)C(=O)O |
| InChI | InChI=1S/C28H30F2N2O6S/c1-16(2)8-10-38-11-9-17-6-5-7-19(25(17)37-4)23-15-39-28(31-23)32-26(33)18-12-21(29)20(22(30)13-18)14-24(36-3)27(34)35/h5-7,12-16H,8-11H2,1-4H3,(H,34,35)(H,31,32,33) |
| InChIKey | ROCRERJVYGREIK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|