C27H27Cl2FN2O5S — CID 23119138
(E)-3-[2,6-dichloro-4-[[4-[3-(3,3-dimethylbutoxymethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid (PubChem CID 23119138) has the molecular formula C27H27Cl2FN2O5S and a molecular weight of 581.49 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[[4-[3-(3,3-dimethylbutoxymethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[[4-[3-(3,3-dimethylbutoxymethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 23119138 |
| Molecular Formula | C27H27Cl2FN2O5S |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[[4-[3-(3,3-dimethylbutoxymethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C/c1c(Cl)cc(C(=O)Nc2nc(-c3cccc(COCCC(C)(C)C)c3F)cs2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C27H27Cl2FN2O5S/c1-27(2,3)8-9-37-13-15-6-5-7-17(23(15)30)21-14-38-26(31-21)32-24(33)16-10-19(28)18(20(29)11-16)12-22(36-4)25(34)35/h5-7,10-12,14H,8-9,13H2,1-4H3,(H,34,35)(H,31,32,33)/b22-12+ |
| InChIKey | JCVGWYZFEIHBKJ-WSDLNYQXSA-N |
| XLogP | 7.53 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|