C27H27Cl2FN2O6S — CID 91190891
3-[4-[[4-[3-(2-butoxy-1-methoxyethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methoxyprop-2-enoic acid (PubChem CID 91190891) has the molecular formula C27H27Cl2FN2O6S and a molecular weight of 597.49 g/mol. Its IUPAC name is 3-[4-[[4-[3-(2-butoxy-1-methoxyethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | 3-[4-[[4-[3-(2-butoxy-1-methoxyethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 91190891 |
| Molecular Formula | C27H27Cl2FN2O6S |
| Molecular Weight | 597.49 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 3-[4-[[4-[3-(2-butoxy-1-methoxyethyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-dichlorophenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CCCCOCC(OC)c1cccc(-c2csc(NC(=O)c3cc(Cl)c(C=C(OC)C(=O)O)c(Cl)c3)n2)c1F |
| InChI | InChI=1S/C27H27Cl2FN2O6S/c1-4-5-9-38-13-23(37-3)17-8-6-7-16(24(17)30)21-14-39-27(31-21)32-25(33)15-10-19(28)18(20(29)11-15)12-22(36-2)26(34)35/h6-8,10-12,14,23H,4-5,9,13H2,1-3H3,(H,34,35)(H,31,32,33) |
| InChIKey | VSKNPDUFXOKTMN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.49 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|