C29H31Cl2FN2O6S — CID 87678004
(Z)-3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)-1-methoxypropyl]-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid (PubChem CID 87678004) has the molecular formula C29H31Cl2FN2O6S and a molecular weight of 625.55 g/mol. Its IUPAC name is (Z)-3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)-1-methoxypropyl]-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)-1-methoxypropyl]-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 87678004 |
| Molecular Formula | C29H31Cl2FN2O6S |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | (Z)-3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)-1-methoxypropyl]-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C\c1c(Cl)cc(C(=O)Nc2nc(-c3cccc(C(CCOCC(C)(C)C)OC)c3F)cs2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C29H31Cl2FN2O6S/c1-29(2,3)15-40-10-9-23(38-4)18-8-6-7-17(25(18)32)22-14-41-28(33-22)34-26(35)16-11-20(30)19(21(31)12-16)13-24(39-5)27(36)37/h6-8,11-14,23H,9-10,15H2,1-5H3,(H,36,37)(H,33,34,35)/b24-13- |
| InChIKey | QUPLIXJYNMCTGG-CFRMEGHHSA-N |
| XLogP | 7.72 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|