C30H33Cl2FN2O5S — CID 23119350
(E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxy-4-pentoxybutyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119350) has the molecular formula C30H33Cl2FN2O5S and a molecular weight of 623.57 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxy-4-pentoxybutyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxy-4-pentoxybutyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119350 |
| Molecular Formula | C30H33Cl2FN2O5S |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxy-4-pentoxybutyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCOCCCC(OC)c1cccc(-c2csc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)n2)c1F |
| InChI | InChI=1S/C30H33Cl2FN2O5S/c1-4-5-6-12-40-13-8-11-26(39-3)21-10-7-9-20(27(21)33)25-17-41-30(34-25)35-28(36)19-15-23(31)22(24(32)16-19)14-18(2)29(37)38/h7,9-10,14-17,26H,4-6,8,11-13H2,1-3H3,(H,37,38)(H,34,35,36)/b18-14+ |
| InChIKey | DQGQKSCRPPXTQM-NBVRZTHBSA-N |
| XLogP | 8.67 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|