C28H29Cl2FN2O5S — CID 23119077
(E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119077) has the molecular formula C28H29Cl2FN2O5S and a molecular weight of 595.52 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119077 |
| Molecular Formula | C28H29Cl2FN2O5S |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCC(OC)c1cccc(-c2nc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)sc2OC)c1F |
| InChI | InChI=1S/C28H29Cl2FN2O5S/c1-5-6-7-11-22(37-3)17-9-8-10-18(23(17)31)24-27(38-4)39-28(32-24)33-25(34)16-13-20(29)19(21(30)14-16)12-15(2)26(35)36/h8-10,12-14,22H,5-7,11H2,1-4H3,(H,35,36)(H,32,33,34)/b15-12+ |
| InChIKey | LSWCPOKDWRSNGJ-NTCAYCPXSA-N |
| XLogP | 8.27 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|