C27H28Cl2N2O5S — CID 74018428
3-[2,6-dichloro-4-[[5-methoxy-4-[3-(3-propoxypropyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 74018428) has the molecular formula C27H28Cl2N2O5S and a molecular weight of 563.50 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[[5-methoxy-4-[3-(3-propoxypropyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[[5-methoxy-4-[3-(3-propoxypropyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 74018428 |
| Molecular Formula | C27H28Cl2N2O5S |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | 3-[2,6-dichloro-4-[[5-methoxy-4-[3-(3-propoxypropyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCOCCCc1cccc(-c2nc(NC(=O)c3cc(Cl)c(C=C(C)C(=O)O)c(Cl)c3)sc2OC)c1 |
| InChI | InChI=1S/C27H28Cl2N2O5S/c1-4-10-36-11-6-8-17-7-5-9-18(13-17)23-26(35-3)37-27(30-23)31-24(32)19-14-21(28)20(22(29)15-19)12-16(2)25(33)34/h5,7,9,12-15H,4,6,8,10-11H2,1-3H3,(H,33,34)(H,30,31,32) |
| InChIKey | WGIPZLBQQMGSQY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|