C28H28F2N2O4S — CID 142680666
3-[2,6-difluoro-4-[[6-(3-propoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 142680666) has the molecular formula C28H28F2N2O4S and a molecular weight of 526.61 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[[6-(3-propoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-difluoro-4-[[6-(3-propoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 142680666 |
| Molecular Formula | C28H28F2N2O4S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-[2,6-difluoro-4-[[6-(3-propoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCOCCCc1cccc2c1CCc1sc(NC(=O)c3cc(F)c(C=C(C)C(=O)O)c(F)c3)nc1-2 |
| InChI | InChI=1S/C28H28F2N2O4S/c1-3-11-36-12-5-7-17-6-4-8-20-19(17)9-10-24-25(20)31-28(37-24)32-26(33)18-14-22(29)21(23(30)15-18)13-16(2)27(34)35/h4,6,8,13-15H,3,5,7,9-12H2,1-2H3,(H,34,35)(H,31,32,33) |
| InChIKey | OZTWVONWJKXURW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|