C27H26F2N2O5S — CID 90889015
3-[4-[[6-(3-ethoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid (PubChem CID 90889015) has the molecular formula C27H26F2N2O5S and a molecular weight of 528.58 g/mol. Its IUPAC name is 3-[4-[[6-(3-ethoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | 3-[4-[[6-(3-ethoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 90889015 |
| Molecular Formula | C27H26F2N2O5S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 3-[4-[[6-(3-ethoxypropyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CCOCCCc1cccc2c1CCc1sc(NC(=O)c3cc(F)c(C=C(OC)C(=O)O)c(F)c3)nc1-2 |
| InChI | InChI=1S/C27H26F2N2O5S/c1-3-36-11-5-7-15-6-4-8-18-17(15)9-10-23-24(18)30-27(37-23)31-25(32)16-12-20(28)19(21(29)13-16)14-22(35-2)26(33)34/h4,6,8,12-14H,3,5,7,9-11H2,1-2H3,(H,33,34)(H,30,31,32) |
| InChIKey | NSCWDOQMYBAEOX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|