C28H24F2N2O3S — CID 23119142
(E)-3-[4-[[6-(3,3-dimethylbut-1-ynyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid (PubChem CID 23119142) has the molecular formula C28H24F2N2O3S and a molecular weight of 506.57 g/mol. Its IUPAC name is (E)-3-[4-[[6-(3,3-dimethylbut-1-ynyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[[6-(3,3-dimethylbut-1-ynyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119142 |
| Molecular Formula | C28H24F2N2O3S |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (E)-3-[4-[[6-(3,3-dimethylbut-1-ynyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(F)cc(C(=O)Nc2nc3c(s2)CCc2c(C#CC(C)(C)C)cccc2-3)cc1F)C(=O)O |
| InChI | InChI=1S/C28H24F2N2O3S/c1-15(26(34)35)12-20-21(29)13-17(14-22(20)30)25(33)32-27-31-24-19-7-5-6-16(10-11-28(2,3)4)18(19)8-9-23(24)36-27/h5-7,12-14H,8-9H2,1-4H3,(H,34,35)(H,31,32,33)/b15-12+ |
| InChIKey | ONPPZWYMWATKHX-NTCAYCPXSA-N |
| XLogP | 6.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|