C26H24Cl2N2O5S — CID 91420868
3-[2,6-dichloro-4-[[6-(2-ethoxyethoxy)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 91420868) has the molecular formula C26H24Cl2N2O5S and a molecular weight of 547.46 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[[6-(2-ethoxyethoxy)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[[6-(2-ethoxyethoxy)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 91420868 |
| Molecular Formula | C26H24Cl2N2O5S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 3-[2,6-dichloro-4-[[6-(2-ethoxyethoxy)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCOCCOc1cccc2c1CCc1sc(NC(=O)c3cc(Cl)c(C=C(C)C(=O)O)c(Cl)c3)nc1-2 |
| InChI | InChI=1S/C26H24Cl2N2O5S/c1-3-34-9-10-35-21-6-4-5-17-16(21)7-8-22-23(17)29-26(36-22)30-24(31)15-12-19(27)18(20(28)13-15)11-14(2)25(32)33/h4-6,11-13H,3,7-10H2,1-2H3,(H,32,33)(H,29,30,31) |
| InChIKey | SQVAGFOUESDWCP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|