C28H28Cl2N2O4S — CID 87681652
(Z)-3-[2,6-dichloro-4-[[6-(3,3-dimethylbutyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid (PubChem CID 87681652) has the molecular formula C28H28Cl2N2O4S and a molecular weight of 559.52 g/mol. Its IUPAC name is (Z)-3-[2,6-dichloro-4-[[6-(3,3-dimethylbutyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[2,6-dichloro-4-[[6-(3,3-dimethylbutyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 87681652 |
| Molecular Formula | C28H28Cl2N2O4S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | (Z)-3-[2,6-dichloro-4-[[6-(3,3-dimethylbutyl)-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C\c1c(Cl)cc(C(=O)Nc2nc3c(s2)CCc2c(CCC(C)(C)C)cccc2-3)cc1Cl)C(=O)O |
| InChI | InChI=1S/C28H28Cl2N2O4S/c1-28(2,3)11-10-15-6-5-7-18-17(15)8-9-23-24(18)31-27(37-23)32-25(33)16-12-20(29)19(21(30)13-16)14-22(36-4)26(34)35/h5-7,12-14H,8-11H2,1-4H3,(H,34,35)(H,31,32,33)/b22-14- |
| InChIKey | SEXUFMAHAOTWOS-HMAPJEAMSA-N |
| XLogP | 7.52 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|