C28H28Cl2N2O4S — CID 90907465
3-[2,6-dichloro-4-[(6-hexoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 90907465) has the molecular formula C28H28Cl2N2O4S and a molecular weight of 559.52 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[(6-hexoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[(6-hexoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 90907465 |
| Molecular Formula | C28H28Cl2N2O4S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 3-[2,6-dichloro-4-[(6-hexoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCOc1cccc2c1CCc1sc(NC(=O)c3cc(Cl)c(C=C(C)C(=O)O)c(Cl)c3)nc1-2 |
| InChI | InChI=1S/C28H28Cl2N2O4S/c1-3-4-5-6-12-36-23-9-7-8-19-18(23)10-11-24-25(19)31-28(37-24)32-26(33)17-14-21(29)20(22(30)15-17)13-16(2)27(34)35/h7-9,13-15H,3-6,10-12H2,1-2H3,(H,34,35)(H,31,32,33) |
| InChIKey | WTLMVRKPNRGFLI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|