C29H30Cl2N2O3S — CID 87681911
(E)-3-[2,6-dichloro-4-[(5-heptyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 87681911) has the molecular formula C29H30Cl2N2O3S and a molecular weight of 557.54 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[(5-heptyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[(5-heptyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87681911 |
| Molecular Formula | C29H30Cl2N2O3S |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[(5-heptyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCCC1Cc2sc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)nc2-c2ccccc21 |
| InChI | InChI=1S/C29H30Cl2N2O3S/c1-3-4-5-6-7-10-18-16-25-26(21-12-9-8-11-20(18)21)32-29(37-25)33-27(34)19-14-23(30)22(24(31)15-19)13-17(2)28(35)36/h8-9,11-15,18H,3-7,10,16H2,1-2H3,(H,35,36)(H,32,33,34)/b17-13+ |
| InChIKey | CCXUCJLWJKUCFU-GHRIWEEISA-N |
| XLogP | 8.86 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|