C28H30Cl2N2O5S — CID 23119293
(E)-3-[2,6-dichloro-4-[[4-(3-heptoxy-2-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119293) has the molecular formula C28H30Cl2N2O5S and a molecular weight of 577.53 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[[4-(3-heptoxy-2-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[[4-(3-heptoxy-2-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119293 |
| Molecular Formula | C28H30Cl2N2O5S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[[4-(3-heptoxy-2-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCCOc1cccc(-c2csc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)n2)c1OC |
| InChI | InChI=1S/C28H30Cl2N2O5S/c1-4-5-6-7-8-12-37-24-11-9-10-19(25(24)36-3)23-16-38-28(31-23)32-26(33)18-14-21(29)20(22(30)15-18)13-17(2)27(34)35/h9-11,13-16H,4-8,12H2,1-3H3,(H,34,35)(H,31,32,33)/b17-13+ |
| InChIKey | ODMAQLPHEBXKLJ-GHRIWEEISA-N |
| XLogP | 8.21 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|