C30H35ClN2O5S — CID 89018703
(E)-3-[2-chloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-6-methylphenyl]-2-methylprop-2-enoic acid (PubChem CID 89018703) has the molecular formula C30H35ClN2O5S and a molecular weight of 571.14 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-6-methylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-6-methylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 89018703 |
| Molecular Formula | C30H35ClN2O5S |
| Molecular Weight | 571.14 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | (E)-3-[2-chloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-6-methylphenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCO[C@@H](C)c1cccc(-c2csc(NC(=O)c3cc(C)c(/C=C(\C)C(=O)O)c(Cl)c3)n2)c1OC |
| InChI | InChI=1S/C30H35ClN2O5S/c1-6-7-8-9-13-38-20(4)22-11-10-12-23(27(22)37-5)26-17-39-30(32-26)33-28(34)21-14-18(2)24(25(31)16-21)15-19(3)29(35)36/h10-12,14-17,20H,6-9,13H2,1-5H3,(H,35,36)(H,32,33,34)/b19-15+/t20-/m0/s1 |
| InChIKey | PGWJZXDTZLMMHE-ZAQQZEBGSA-N |
| XLogP | 8.18 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.14 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|