C31H35Cl2FN2O4S — CID 74018349
3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxydecyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 74018349) has the molecular formula C31H35Cl2FN2O4S and a molecular weight of 621.60 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxydecyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxydecyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 74018349 |
| Molecular Formula | C31H35Cl2FN2O4S |
| Molecular Weight | 621.60 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxydecyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCCCCC(OC)c1cccc(-c2csc(NC(=O)c3cc(Cl)c(C=C(C)C(=O)O)c(Cl)c3)n2)c1F |
| InChI | InChI=1S/C31H35Cl2FN2O4S/c1-4-5-6-7-8-9-10-14-27(40-3)22-13-11-12-21(28(22)34)26-18-41-31(35-26)36-29(37)20-16-24(32)23(25(33)17-20)15-19(2)30(38)39/h11-13,15-18,27H,4-10,14H2,1-3H3,(H,38,39)(H,35,36,37) |
| InChIKey | KJHICKFWTAURFK-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.60 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|