C30H33F3N2O4S — CID 73024914
3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-pentoxypentyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 73024914) has the molecular formula C30H33F3N2O4S and a molecular weight of 574.67 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-pentoxypentyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-pentoxypentyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 73024914 |
| Molecular Formula | C30H33F3N2O4S |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-pentoxypentyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCOC(CCCC)c1cccc(-c2csc(NC(=O)c3cc(F)c(C=C(C)C(=O)O)c(F)c3)n2)c1F |
| InChI | InChI=1S/C30H33F3N2O4S/c1-4-6-8-13-39-26(12-7-5-2)21-11-9-10-20(27(21)33)25-17-40-30(34-25)35-28(36)19-15-23(31)22(24(32)16-19)14-18(3)29(37)38/h9-11,14-17,26H,4-8,12-13H2,1-3H3,(H,37,38)(H,34,35,36) |
| InChIKey | UHBSOVTXTOTVIC-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|