C27H27F3N2O4S — CID 23119418
(E)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(4-methylpentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119418) has the molecular formula C27H27F3N2O4S and a molecular weight of 532.58 g/mol. Its IUPAC name is (E)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(4-methylpentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(4-methylpentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119418 |
| Molecular Formula | C27H27F3N2O4S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | (E)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(4-methylpentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(F)cc(C(=O)Nc2nc(-c3cccc(COCCCC(C)C)c3F)cs2)cc1F)C(=O)O |
| InChI | InChI=1S/C27H27F3N2O4S/c1-15(2)6-5-9-36-13-17-7-4-8-19(24(17)30)23-14-37-27(31-23)32-25(33)18-11-21(28)20(22(29)12-18)10-16(3)26(34)35/h4,7-8,10-12,14-15H,5-6,9,13H2,1-3H3,(H,34,35)(H,31,32,33)/b16-10+ |
| InChIKey | GNPGMIDKLHVFLU-MHWRWJLKSA-N |
| XLogP | 6.92 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|