C29H32F2N2O5S — CID 23119070
(E)-3-[4-[[4-[3-[2-(2-ethylbutoxy)ethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid (PubChem CID 23119070) has the molecular formula C29H32F2N2O5S and a molecular weight of 558.65 g/mol. Its IUPAC name is (E)-3-[4-[[4-[3-[2-(2-ethylbutoxy)ethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[3-[2-(2-ethylbutoxy)ethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119070 |
| Molecular Formula | C29H32F2N2O5S |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | (E)-3-[4-[[4-[3-[2-(2-ethylbutoxy)ethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
| SMILES | CCC(CC)COCCc1cccc(-c2csc(NC(=O)c3cc(F)c(/C=C(\C)C(=O)O)c(F)c3)n2)c1OC |
| InChI | InChI=1S/C29H32F2N2O5S/c1-5-18(6-2)15-38-11-10-19-8-7-9-21(26(19)37-4)25-16-39-29(32-25)33-27(34)20-13-23(30)22(24(31)14-20)12-17(3)28(35)36/h7-9,12-14,16,18H,5-6,10-11,15H2,1-4H3,(H,35,36)(H,32,33,34)/b17-12+ |
| InChIKey | QDRWGCTVRBMAGF-SFQUDFHCSA-N |
| XLogP | 6.83 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|