C26H25F3N2O4S — CID 74018343
3-[2,6-difluoro-4-[[4-[2-fluoro-3-(pentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 74018343) has the molecular formula C26H25F3N2O4S and a molecular weight of 518.56 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[[4-[2-fluoro-3-(pentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-difluoro-4-[[4-[2-fluoro-3-(pentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 74018343 |
| Molecular Formula | C26H25F3N2O4S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 3-[2,6-difluoro-4-[[4-[2-fluoro-3-(pentoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCOCc1cccc(-c2csc(NC(=O)c3cc(F)c(C=C(C)C(=O)O)c(F)c3)n2)c1F |
| InChI | InChI=1S/C26H25F3N2O4S/c1-3-4-5-9-35-13-16-7-6-8-18(23(16)29)22-14-36-26(30-22)31-24(32)17-11-20(27)19(21(28)12-17)10-15(2)25(33)34/h6-8,10-12,14H,3-5,9,13H2,1-2H3,(H,33,34)(H,30,31,32) |
| InChIKey | BHOVWYIKKWTRLY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|