C27H28F2N2O5S — CID 23119459
(E)-3-[2,6-difluoro-4-[[4-[2-methoxy-3-(3-methylbutoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119459) has the molecular formula C27H28F2N2O5S and a molecular weight of 530.59 g/mol. Its IUPAC name is (E)-3-[2,6-difluoro-4-[[4-[2-methoxy-3-(3-methylbutoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-difluoro-4-[[4-[2-methoxy-3-(3-methylbutoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119459 |
| Molecular Formula | C27H28F2N2O5S |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (E)-3-[2,6-difluoro-4-[[4-[2-methoxy-3-(3-methylbutoxymethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1c(COCCC(C)C)cccc1-c1csc(NC(=O)c2cc(F)c(/C=C(\C)C(=O)O)c(F)c2)n1 |
| InChI | InChI=1S/C27H28F2N2O5S/c1-15(2)8-9-36-13-17-6-5-7-19(24(17)35-4)23-14-37-27(30-23)31-25(32)18-11-21(28)20(22(29)12-18)10-16(3)26(33)34/h5-7,10-12,14-15H,8-9,13H2,1-4H3,(H,33,34)(H,30,31,32)/b16-10+ |
| InChIKey | WILKRIRNXRUQIY-MHWRWJLKSA-N |
| XLogP | 6.40 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|