C32H37F3N2O5S — CID 91352090
3-[4-[[4-[3-(1,4-dibutoxybutyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid (PubChem CID 91352090) has the molecular formula C32H37F3N2O5S and a molecular weight of 618.72 g/mol. Its IUPAC name is 3-[4-[[4-[3-(1,4-dibutoxybutyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-[[4-[3-(1,4-dibutoxybutyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 91352090 |
| Molecular Formula | C32H37F3N2O5S |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 3-[4-[[4-[3-(1,4-dibutoxybutyl)-2-fluorophenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCOCCCC(OCCCC)c1cccc(-c2csc(NC(=O)c3cc(F)c(C=C(C)C(=O)O)c(F)c3)n2)c1F |
| InChI | InChI=1S/C32H37F3N2O5S/c1-4-6-13-41-14-9-12-28(42-15-7-5-2)23-11-8-10-22(29(23)35)27-19-43-32(36-27)37-30(38)21-17-25(33)24(26(34)18-21)16-20(3)31(39)40/h8,10-11,16-19,28H,4-7,9,12-15H2,1-3H3,(H,39,40)(H,36,37,38) |
| InChIKey | XXCOTVUSZHGCIZ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|