C31H34Cl2FN3O5S — CID 23119368
(E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-morpholin-4-yl-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119368) has the molecular formula C31H34Cl2FN3O5S and a molecular weight of 650.60 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-morpholin-4-yl-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-morpholin-4-yl-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119368 |
| Molecular Formula | C31H34Cl2FN3O5S |
| Molecular Weight | 650.60 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-morpholin-4-yl-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCC(OC)c1cccc(-c2nc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)sc2N2CCOCC2)c1F |
| InChI | InChI=1S/C31H34Cl2FN3O5S/c1-4-5-6-10-25(41-3)20-8-7-9-21(26(20)34)27-29(37-11-13-42-14-12-37)43-31(35-27)36-28(38)19-16-23(32)22(24(33)17-19)15-18(2)30(39)40/h7-9,15-17,25H,4-6,10-14H2,1-3H3,(H,39,40)(H,35,36,38)/b18-15+ |
| InChIKey | VMODAHQYJRKLDU-OBGWFSINSA-N |
| XLogP | 8.10 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|