C28H29F3N2O6S — CID 142680674
(Z)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid (PubChem CID 142680674) has the molecular formula C28H29F3N2O6S and a molecular weight of 578.61 g/mol. Its IUPAC name is (Z)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 142680674 |
| Molecular Formula | C28H29F3N2O6S |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | (Z)-3-[2,6-difluoro-4-[[4-[2-fluoro-3-(1-methoxyhexyl)phenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CCCCCC(OC)c1cccc(-c2nc(NC(=O)c3cc(F)c(/C=C(\OC)C(=O)O)c(F)c3)sc2OC)c1F |
| InChI | InChI=1S/C28H29F3N2O6S/c1-5-6-7-11-21(37-2)16-9-8-10-17(23(16)31)24-27(39-4)40-28(32-24)33-25(34)15-12-19(29)18(20(30)13-15)14-22(38-3)26(35)36/h8-10,12-14,21H,5-7,11H2,1-4H3,(H,35,36)(H,32,33,34)/b22-14- |
| InChIKey | CFLCQZXYEUPKPP-HMAPJEAMSA-N |
| XLogP | 6.83 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|