C29H31Cl2FN2O5S — CID 74018351
3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)propyl]-2-fluorophenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 74018351) has the molecular formula C29H31Cl2FN2O5S and a molecular weight of 609.55 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)propyl]-2-fluorophenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)propyl]-2-fluorophenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 74018351 |
| Molecular Formula | C29H31Cl2FN2O5S |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 3-[2,6-dichloro-4-[[4-[3-[3-(2,2-dimethylpropoxy)propyl]-2-fluorophenyl]-5-methoxy-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1sc(NC(=O)c2cc(Cl)c(C=C(C)C(=O)O)c(Cl)c2)nc1-c1cccc(CCCOCC(C)(C)C)c1F |
| InChI | InChI=1S/C29H31Cl2FN2O5S/c1-16(26(36)37)12-20-21(30)13-18(14-22(20)31)25(35)34-28-33-24(27(38-5)40-28)19-10-6-8-17(23(19)32)9-7-11-39-15-29(2,3)4/h6,8,10,12-14H,7,9,11,15H2,1-5H3,(H,36,37)(H,33,34,35) |
| InChIKey | NXHQQWIHGPXBGW-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|