C29H30Cl2FNO4S — CID 23119458
(E)-3-[2,6-dichloro-4-[4-[3-[3-(2-ethylbutoxy)propyl]-2-fluorophenyl]-1,3-thiazole-2-carbonyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23119458) has the molecular formula C29H30Cl2FNO4S and a molecular weight of 578.53 g/mol. Its IUPAC name is (E)-3-[2,6-dichloro-4-[4-[3-[3-(2-ethylbutoxy)propyl]-2-fluorophenyl]-1,3-thiazole-2-carbonyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-dichloro-4-[4-[3-[3-(2-ethylbutoxy)propyl]-2-fluorophenyl]-1,3-thiazole-2-carbonyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23119458 |
| Molecular Formula | C29H30Cl2FNO4S |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | (E)-3-[2,6-dichloro-4-[4-[3-[3-(2-ethylbutoxy)propyl]-2-fluorophenyl]-1,3-thiazole-2-carbonyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCC(CC)COCCCc1cccc(-c2csc(C(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)n2)c1F |
| InChI | InChI=1S/C29H30Cl2FNO4S/c1-4-18(5-2)15-37-11-7-9-19-8-6-10-21(26(19)32)25-16-38-28(33-25)27(34)20-13-23(30)22(24(31)14-20)12-17(3)29(35)36/h6,8,10,12-14,16,18H,4-5,7,9,11,15H2,1-3H3,(H,35,36)/b17-12+ |
| InChIKey | HPWAUXBHQGBGJS-SFQUDFHCSA-N |
| XLogP | 8.36 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|