C26H24Cl2FNNa2O4S — CID 69067225
CID 69067225 (PubChem CID 69067225) has the molecular formula C26H24Cl2FNNa2O4S and a molecular weight of 582.43 g/mol.
| Compound Name | CID 69067225 |
|---|---|
| PubChem CID | 69067225 |
| Molecular Formula | C26H24Cl2FNNa2O4S |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | — |
| SMILES | CCCOCCCc1cccc(-c2csc(C(=O)c3cc(Cl)c(C=C(C)C(=O)O)c(Cl)c3)n2)c1F.[Na].[Na] |
| InChI | InChI=1S/C26H24Cl2FNO4S.2Na/c1-3-9-34-10-5-7-16-6-4-8-18(23(16)29)22-14-35-25(30-22)24(31)17-12-20(27)19(21(28)13-17)11-15(2)26(32)33;;/h4,6,8,11-14H,3,5,7,9-10H2,1-2H3,(H,32,33);; |
| InChIKey | SSHYTBSBEVLSND-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|