C21H15F3N2O5S — CID 23119444
(E)-3-[2,6-difluoro-4-[[4-(2-fluoro-3-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid (PubChem CID 23119444) has the molecular formula C21H15F3N2O5S and a molecular weight of 464.42 g/mol. Its IUPAC name is (E)-3-[2,6-difluoro-4-[[4-(2-fluoro-3-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-difluoro-4-[[4-(2-fluoro-3-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 23119444 |
| Molecular Formula | C21H15F3N2O5S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | (E)-3-[2,6-difluoro-4-[[4-(2-fluoro-3-methoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C/c1c(F)cc(C(=O)Nc2nc(-c3cccc(OC)c3F)cs2)cc1F)C(=O)O |
| InChI | InChI=1S/C21H15F3N2O5S/c1-30-16-5-3-4-11(18(16)24)15-9-32-21(25-15)26-19(27)10-6-13(22)12(14(23)7-10)8-17(31-2)20(28)29/h3-9H,1-2H3,(H,28,29)(H,25,26,27)/b17-8+ |
| InChIKey | UYYPVWDRBIJVBF-CAOOACKPSA-N |
| XLogP | 4.56 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|