C29H30F2N2O5S — CID 23119319
(E)-3-[4-[[4-[3-(2-cyclohexylethoxy)-2-methylphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid (PubChem CID 23119319) has the molecular formula C29H30F2N2O5S and a molecular weight of 556.63 g/mol. Its IUPAC name is (E)-3-[4-[[4-[3-(2-cyclohexylethoxy)-2-methylphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[3-(2-cyclohexylethoxy)-2-methylphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 23119319 |
| Molecular Formula | C29H30F2N2O5S |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (E)-3-[4-[[4-[3-(2-cyclohexylethoxy)-2-methylphenyl]-1,3-thiazol-2-yl]carbamoyl]-2,6-difluorophenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C/c1c(F)cc(C(=O)Nc2nc(-c3cccc(OCCC4CCCCC4)c3C)cs2)cc1F)C(=O)O |
| InChI | InChI=1S/C29H30F2N2O5S/c1-17-20(9-6-10-25(17)38-12-11-18-7-4-3-5-8-18)24-16-39-29(32-24)33-27(34)19-13-22(30)21(23(31)14-19)15-26(37-2)28(35)36/h6,9-10,13-16,18H,3-5,7-8,11-12H2,1-2H3,(H,35,36)(H,32,33,34)/b26-15+ |
| InChIKey | YRGSXQZTYVTROS-CVKSISIWSA-N |
| XLogP | 7.07 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|