C8H14N2O4Pt — CID 175675478
[(1R,2R)-2-azanidyl-1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]azanide;oxalic acid;platinum(2+) (PubChem CID 175675478) has the molecular formula C8H14N2O4Pt and a molecular weight of 407.35 g/mol. Its IUPAC name is [(1R,2R)-2-azanidyl-1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]azanide;oxalic acid;platinum(2+).
| Compound Name | [(1R,2R)-2-azanidyl-1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]azanide;oxalic acid;platinum(2+) |
|---|---|
| PubChem CID | 175675478 |
| Molecular Formula | C8H14N2O4Pt |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(1R,2R)-2-azanidyl-1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]azanide;oxalic acid;platinum(2+) |
| SMILES | O=C(O)C(=O)O.[2H]C1([2H])C([2H])([2H])C([2H])([2H])[C@@]([2H])([NH-])[C@]([2H])([NH-])C1([2H])[2H].[Pt+2] |
| InChI | InChI=1S/C6H12N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-8H,1-4H2;(H,3,4)(H,5,6);/q-2;;+2/t5-,6-;;/m1../s1/i1D2,2D2,3D2,4D2,5D,6D;; |
| InChIKey | DRMCATBEKSVAPL-YYKMXZQESA-N |
| XLogP | 1.56 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|