C17H23NO9 — CID 175678926
2-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylamino]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 175678926) has the molecular formula C17H23NO9 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylamino]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylamino]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175678926 |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylamino]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | CC(C)N(CC(O)c1ccc(O)c(O)c1)C(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23NO9/c1-9(2)18(8-13(21)10-3-4-11(19)12(20)5-10)14(22)6-17(27,16(25)26)7-15(23)24/h3-5,9,13,19-21,27H,6-8H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | WVUPBNVJPNFALD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|