C27H34Cl2FN3O5 — CID 175696520
3-[4-[bis(2-chloroethyl)amino]phenyl]-3-(4-fluorophenyl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoic acid (PubChem CID 175696520) has the molecular formula C27H34Cl2FN3O5 and a molecular weight of 570.49 g/mol. Its IUPAC name is 3-[4-[bis(2-chloroethyl)amino]phenyl]-3-(4-fluorophenyl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoic acid.
| Compound Name | 3-[4-[bis(2-chloroethyl)amino]phenyl]-3-(4-fluorophenyl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 175696520 |
| Molecular Formula | C27H34Cl2FN3O5 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 3-[4-[bis(2-chloroethyl)amino]phenyl]-3-(4-fluorophenyl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC(C(=O)O)C(c1ccc(F)cc1)c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C27H34Cl2FN3O5/c1-27(2,3)38-26(37)31-15-12-22(34)32-24(25(35)36)23(18-4-8-20(30)9-5-18)19-6-10-21(11-7-19)33(16-13-28)17-14-29/h4-11,23-24H,12-17H2,1-3H3,(H,31,37)(H,32,34)(H,35,36) |
| InChIKey | QHSKFLXZTXZTGJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|