C20H40K2N2O7S — CID 175700171
dipotassium;2-aminoethanesulfonic acid;(2S)-2-(tetradecylamino)butanedioate (PubChem CID 175700171) has the molecular formula C20H40K2N2O7S and a molecular weight of 530.81 g/mol. Its IUPAC name is dipotassium;2-aminoethanesulfonic acid;(2S)-2-(tetradecylamino)butanedioate.
| Compound Name | dipotassium;2-aminoethanesulfonic acid;(2S)-2-(tetradecylamino)butanedioate |
|---|---|
| PubChem CID | 175700171 |
| Molecular Formula | C20H40K2N2O7S |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | dipotassium;2-aminoethanesulfonic acid;(2S)-2-(tetradecylamino)butanedioate |
| SMILES | CCCCCCCCCCCCCCN[C@@H](CC(=O)[O-])C(=O)[O-].NCCS(=O)(=O)O.[K+].[K+] |
| InChI | InChI=1S/C18H35NO4.C2H7NO3S.2K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-16(18(22)23)15-17(20)21;3-1-2-7(4,5)6;;/h16,19H,2-15H2,1H3,(H,20,21)(H,22,23);1-3H2,(H,4,5,6);;/q;;2*+1/p-2/t16-;;;/m0.../s1 |
| InChIKey | RXYOGXMUCFUQBB-OKUPDQQSSA-L |
| XLogP | -5.62 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | -5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|