C22H25ClN5P — CID 175702881
5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-pyrrolidin-3-yl-2-pyridinyl)pyridine-2,4-diamine (PubChem CID 175702881) has the molecular formula C22H25ClN5P and a molecular weight of 425.90 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-pyrrolidin-3-yl-2-pyridinyl)pyridine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-pyrrolidin-3-yl-2-pyridinyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 175702881 |
| Molecular Formula | C22H25ClN5P |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphanylphenyl)-2-N-(4-pyrrolidin-3-yl-2-pyridinyl)pyridine-2,4-diamine |
| SMILES | CP(C)c1ccccc1Nc1cc(Nc2cc(C3CCNC3)ccn2)ncc1Cl |
| InChI | InChI=1S/C22H25ClN5P/c1-29(2)20-6-4-3-5-18(20)27-19-12-22(26-14-17(19)23)28-21-11-15(8-10-25-21)16-7-9-24-13-16/h3-6,8,10-12,14,16,24H,7,9,13H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | RAQBSULGFZQZTM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|