C12H16N6O5 — CID 175705438
N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[6-(methylamino)purin-9-yl]oxolan-2-yl]formamide (PubChem CID 175705438) has the molecular formula C12H16N6O5 and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[6-(methylamino)purin-9-yl]oxolan-2-yl]formamide.
| Compound Name | N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[6-(methylamino)purin-9-yl]oxolan-2-yl]formamide |
|---|---|
| PubChem CID | 175705438 |
| Molecular Formula | C12H16N6O5 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[6-(methylamino)purin-9-yl]oxolan-2-yl]formamide |
| SMILES | CNc1ncnc2c1ncn2[C@]1(NC=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N6O5/c1-13-10-7-11(15-3-14-10)18(4-16-7)12(17-5-20)9(22)8(21)6(2-19)23-12/h3-6,8-9,19,21-22H,2H2,1H3,(H,17,20)(H,13,14,15)/t6-,8-,9-,12+/m1/s1 |
| InChIKey | GQLDJXCXLNWBSD-PPSWKLDYSA-N |
| XLogP | -2.66 |
| TPSA | 154.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|