C13H18N2O — CID 175724614
6-benzyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3a-ol (PubChem CID 175724614) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-benzyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3a-ol.
| Compound Name | 6-benzyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3a-ol |
|---|---|
| PubChem CID | 175724614 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 6-benzyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3a-ol |
| SMILES | OC12CNCC1C(Cc1ccccc1)NC2 |
| InChI | InChI=1S/C13H18N2O/c16-13-8-14-7-11(13)12(15-9-13)6-10-4-2-1-3-5-10/h1-5,11-12,14-16H,6-9H2 |
| InChIKey | BHIGMOQOHPXHAR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |