C17H17ClF3NO4 — CID 175734181
ethyl (2R)-1-[4-chloro-3-(trifluoromethyl)benzoyl]-2-methyl-5-oxopiperidine-4-carboxylate (PubChem CID 175734181) has the molecular formula C17H17ClF3NO4 and a molecular weight of 391.77 g/mol. Its IUPAC name is ethyl (2R)-1-[4-chloro-3-(trifluoromethyl)benzoyl]-2-methyl-5-oxopiperidine-4-carboxylate.
| Compound Name | ethyl (2R)-1-[4-chloro-3-(trifluoromethyl)benzoyl]-2-methyl-5-oxopiperidine-4-carboxylate |
|---|---|
| PubChem CID | 175734181 |
| Molecular Formula | C17H17ClF3NO4 |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | ethyl (2R)-1-[4-chloro-3-(trifluoromethyl)benzoyl]-2-methyl-5-oxopiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H](C)N(C(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1=O |
| InChI | InChI=1S/C17H17ClF3NO4/c1-3-26-16(25)11-6-9(2)22(8-14(11)23)15(24)10-4-5-13(18)12(7-10)17(19,20)21/h4-5,7,9,11H,3,6,8H2,1-2H3/t9-,11?/m1/s1 |
| InChIKey | DTUJJFADIUBOGH-BFHBGLAWSA-N |
| XLogP | 3.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|