About acetate;gold(1+)
acetate;gold(1+) (PubChem CID 175738141) has the molecular formula C2H2AuO2-
and a molecular weight of 255.00 g/mol. Its IUPAC name is acetate;gold(1+).
Molecular Properties
| Compound Name | acetate;gold(1+) |
| PubChem CID | 175738141 |
| Molecular Formula | C2H2AuO2- |
| Molecular Weight | 255.00 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | acetate;gold(1+) |
| SMILES | [Au+].[CH2-]C(=O)[O-] |
| InChI | InChI=1S/C2H3O2.Au/c1-2(3)4;/h1H2,(H,3,4);/q-1;+1/p-1 |
| InChIKey | ZATMFOCLZBIUAI-UHFFFAOYSA-M |
| XLogP | -1.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.00 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze acetate;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetate;gold(1+)?
The IUPAC name of acetate;gold(1+) (CID 175738141) is acetate;gold(1+).
What is the SMILES notation for acetate;gold(1+)?
The canonical SMILES for acetate;gold(1+) is [Au+].[CH2-]C(=O)[O-].
What is the InChIKey of acetate;gold(1+)?
The InChIKey is ZATMFOCLZBIUAI-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3O2.Au/c1-2(3)4;/h1H2,(H,3,4);/q-1;+1/p-1.
What are the key properties of acetate;gold(1+)?
acetate;gold(1+) has a molecular weight of 255.00 g/mol, XLogP of -1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetate;gold(1+) is sourced from PubChem (CID 175738141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).