C7H13ClN2 — CID 175746267
1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridine;hydrochloride (PubChem CID 175746267) has the molecular formula C7H13ClN2 and a molecular weight of 160.65 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridine;hydrochloride.
| Compound Name | 1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridine;hydrochloride |
|---|---|
| PubChem CID | 175746267 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridine;hydrochloride |
| SMILES | C1=C2CNCN2CCC1.Cl |
| InChI | InChI=1S/C7H12N2.ClH/c1-2-4-9-6-8-5-7(9)3-1;/h3,8H,1-2,4-6H2;1H |
| InChIKey | UBDSAZJCZALREE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |