C11H15N — CID 132565493
9-ethenyl-3,4,6,7-tetrahydro-2H-quinolizine (PubChem CID 132565493) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 9-ethenyl-3,4,6,7-tetrahydro-2H-quinolizine.
| Compound Name | 9-ethenyl-3,4,6,7-tetrahydro-2H-quinolizine |
|---|---|
| PubChem CID | 132565493 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 9-ethenyl-3,4,6,7-tetrahydro-2H-quinolizine |
| SMILES | C=CC1=CCCN2CCCC=C12 |
| InChI | InChI=1S/C11H15N/c1-2-10-6-5-9-12-8-4-3-7-11(10)12/h2,6-7H,1,3-5,8-9H2 |
| InChIKey | OKUINQGDNRYNHN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |