C10H12O — CID 89328254
1-(6-ethenylcyclohexa-1,5-dien-1-yl)ethenol (PubChem CID 89328254) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 1-(6-ethenylcyclohexa-1,5-dien-1-yl)ethenol.
| Compound Name | 1-(6-ethenylcyclohexa-1,5-dien-1-yl)ethenol |
|---|---|
| PubChem CID | 89328254 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-(6-ethenylcyclohexa-1,5-dien-1-yl)ethenol |
| SMILES | C=CC1=CCCC=C1C(=C)O |
| InChI | InChI=1S/C10H12O/c1-3-9-6-4-5-7-10(9)8(2)11/h3,6-7,11H,1-2,4-5H2 |
| InChIKey | ZIHDYFKOXBRBHS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|