C14H25N — CID 155731579
ethane;N-(6-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 155731579) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;N-(6-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)methanimine.
| Compound Name | ethane;N-(6-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 155731579 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;N-(6-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | C=NC1=CCCC=C1C(=C)C.CC.CC |
| InChI | InChI=1S/C10H13N.2C2H6/c1-8(2)9-6-4-5-7-10(9)11-3;2*1-2/h6-7H,1,3-5H2,2H3;2*1-2H3 |
| InChIKey | OMSQXRZYUXTVRS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|