C10H14N2O — CID 163445325
1-[[6-(methylideneamino)cyclohexa-1,5-dien-1-yl]amino]prop-2-en-1-ol (PubChem CID 163445325) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-[[6-(methylideneamino)cyclohexa-1,5-dien-1-yl]amino]prop-2-en-1-ol.
| Compound Name | 1-[[6-(methylideneamino)cyclohexa-1,5-dien-1-yl]amino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 163445325 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-[[6-(methylideneamino)cyclohexa-1,5-dien-1-yl]amino]prop-2-en-1-ol |
| SMILES | C=CC(O)NC1=CCCC=C1N=C |
| InChI | InChI=1S/C10H14N2O/c1-3-10(13)12-9-7-5-4-6-8(9)11-2/h3,6-7,10,12-13H,1-2,4-5H2 |
| InChIKey | BCADPCHWSQBNHH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|