C11H17N — CID 144546246
N-(5-ethenylcyclopenta-1,4-dien-1-yl)methanimine;propane (PubChem CID 144546246) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-(5-ethenylcyclopenta-1,4-dien-1-yl)methanimine;propane.
| Compound Name | N-(5-ethenylcyclopenta-1,4-dien-1-yl)methanimine;propane |
|---|---|
| PubChem CID | 144546246 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-(5-ethenylcyclopenta-1,4-dien-1-yl)methanimine;propane |
| SMILES | C=CC1=CCC=C1N=C.CCC |
| InChI | InChI=1S/C8H9N.C3H8/c1-3-7-5-4-6-8(7)9-2;1-3-2/h3,5-6H,1-2,4H2;3H2,1-2H3 |
| InChIKey | FTQQITFLFQOWLR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|